| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3004490 |
| Synonym(s) | deltyba |
| Definition | A novel nitroimidazole antibiotic for treating Mycobacterium tuberculosis infection. Delamanid inhibits bacterial cell wall growth by mycolic acid synthesis disruption and is particularly effective in combination therapies against multidrug-resistant tuberculosis. |
| SMILES | C[C@]1(COc2ccc(N3CCC(Oc4ccc(OC(F)(F)F)cc4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| PubChem | 6480466 |
| ChEMBL | CHEMBL218650 |
| ChEBI | 134742 |
| CAS | 681492-22-8 |
| Drug Class | nitroimidazole antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + nitroimidazole antibiotic [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + Mycobacterium tuberculosis ddn mutation conferring resistance to nitroimidazole antibiotics confers_resistance_to_antibiotic + Mycobacterium tuberculosis fgd1 with mutation conferring resistance to delamanid confers_resistance_to_antibiotic |
| Publications | Xavier AS, et al. 2014. J Pharmacol Pharmacother 5(3):222-4 Delamanid: A new armor in combating drug-resistant tuberculosis. (PMID 25210407) |
| Curator | Description | Most Recent Edit |
|---|