| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007314 |
| Synonym(s) | Nebupent Pentam |
| Definition | Pentamidine is an antiparasitic compound used to treat a variety of infections such as African trypanosomiasis and leishamaniasis. It has also been shown to increase Gram-negative membrane permeability and enhance the entry of certain antibiotics. Pentamidine combined with linezolid had significant synergistic antibacterial effects against carbapenem-resistant Enterobacteriaceae pentamidine. The antimicrobial disrupts the outer membranes, dissipates the membrane potentials, and devitalizes the efflux pumps of CRE, thereby facilitating the intracellular accumulation of linezolid and reactive oxygen species (ROS), which ultimately kills the bacteria. |
| SMILES | N=C(N)c1ccc(OCCCCCOc2ccc(C(=N)N)cc2)cc1 |
| PubChem | 4735 |
| CHEBI | 45081 |
| ChEMBL | CHEMBL55 |
| CAS | 100-33-4 |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 1 ontology terms | Show + Pneumocystis jerovecii dhfr with mutations associated with resistance to pentamidine confers_resistance_to_antibiotic |
| Publications | Stokes JM, et al. 2017. Nat Microbiol 2:17028 Pentamidine sensitizes Gram-negative pathogens to antibiotics and overcomes acquired colistin resistance. (PMID 28263303) |
| Curator | Description | Most Recent Edit |
|---|