| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007685 |
| Definition | Nifuratel is a nitrofuran antibiotic already in use for parasitic infections. It was effective against different serovars, including multidrug-resistant strains of Salmonella Typhimurium, and in macrophages from different host species and against Listeria monocytogenes and Shigella flexneri. It reduced IL-10 and STAT3 production in infected macrophages which should increase the inflammatory response against Salmonella. |
| SMILES | CSCC1CN(/N=C/c2ccc([N+](=O)[O-])o2)C(=O)O1 |
| PubChem | 6433427 |
| ChEBI | 135180 |
| CAS | 4936-47-4 |
| ChEMBL | CHEMBL514315 |
| Drug Class | nitrofuran antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + nitrofuran antibiotic [Drug Class] |
| Publications | Xie T, et al. 2023. Microbiol Spectr :e0514722 Nifuratel reduces Salmonella survival in macrophages by extracellular and intracellular antibacterial activity. (PMID 37732770) |
| Curator | Description | Most Recent Edit |
|---|