| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3009161 |
| Definition | A foliar fungicide used to control a wide range of Ascomycetes and Fungi Imperfecti in a wide range of crops. |
| SMILES | CCCCNC(=O)N1C2=CC=CC=C2N=C1NC(=O)OC |
| PubChem | 28780 |
| CAS | 17804-35-2 |
| ChEMBL | CHEMBL327919 |
| Drug Class | benzimidazole antifungal |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + benzimidazole antifungal [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + Colletotrichum gloeosporioides beta-tubulin with mutations conferring resistance against benomyl confers_resistance_to_antibiotic + Aspergillus fumigatus beta-tubulin with mutations conferring resistance to benomyl confers_resistance_to_antibiotic |
| Publications | Gonzalez-Jimenez I, et al. 2021. Antimicrob Agents Chemother 65(9):e0064221 Multiresistance to Nonazole Fungicides in Aspergillus fumigatus TR34/L98H Azole-Resistant Isolates. (PMID 34152819) |
| Curator | Description | Most Recent Edit |
|---|