| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3009304 |
| Definition | Strobilurins, also known as QOI fungicides, are a group of fungicides originally isolated from the fungus Strobilurus tenacellus that inhibit mitochondrial respiration by binding to Complex III in the electron transport chain thereby disrupting the fungus's ability to produce energy. |
| SMILES | COC(=O)N(C1=CC=CC=C1COC2=NN(C=C2)C3=CC=C(C=C3)Cl)OC |
| PubChem | 6422843 |
| CAS | 175013-18-0 |
| CHEBI | 78780 |
| ChEMBL | CHEMBL519873 |
| Drug Class | strobilurin fungicide |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + strobilurin fungicide [Drug Class] |
| Sub-Term(s) | 3 ontology terms | Show + Colletotrichum gloeosporioides cytochrome b protein with mutations conferring resistance to pyraclostrobin confers_resistance_to_antibiotic + Aspergillus fumigatus beta-tubulin with mutations conferring resistance to pyraclostrobin confers_resistance_to_antibiotic + Aspergillus fumigatus Cyp51A with mutations conferring resistance to pyraclostrobin confers_resistance_to_antibiotic |
| Publications | Herms S, et al. 2002. Plant Physiol 130(1):120-7 A strobilurin fungicide enhances the resistance of tobacco against tobacco mosaic virus and Pseudomonas syringae pv tabaci. (PMID 12226492) |
| Curator | Description | Most Recent Edit |
|---|