| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000055 |
| Synonym(s) | Aizumycin Bacfeed Bacteron Bicozamicina Bicozamycin Bicozamycine Bicozamycinum |
| Definition | Bicyclomycin represents a unique class of antibiotics, discovered in 1972. It is obtained by the fermentation of Streptomyces sapporonensis. In the crystalline form bicyclomycin is observed to be rhombic or monoclinic, depending on the solvent used. This antibiotic kills bacteria by inhibiting the Rho transcription terminator factor, halting ribonucleic acid (RNA) synthesis. |
| SMILES | C=C1CCO[C@]2([C@@H](O)[C@@](C)(O)CO)NC(=O)[C@@]1(O)NC2=O |
| PubChem | 65807 |
| ChEMBL | CHEMBL1231250 |
| ChEBI | 60584 |
| CAS | 38129-37-2 |
| Drug Class | bicyclomycin-like antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + bicyclomycin-like antibiotic [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + rho transcription terminator factor targeted_by_antibiotic + bcr-1 confers_resistance_to_antibiotic |
| Publications | Park HG, et al. 1995. Arch Biochem Biophys 323(2): 447-454. Bicyclomycin and dihydrobicyclomycin inhibition kinetics of Escherichia coli rho-dependent transcription termination factor ATPase activity. (PMID 7487110) Kohn H and Widger W. 2005. Curr Drug Targets Infect Disord 5(3): 273-295. The molecular basis for the mode of action of bicyclomycin. (PMID 16181146) |
| Curator | Description | Most Recent Edit |
|---|