| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3004567 |
| Definition | Ramoplanin is a glycolipodepsipeptide antibiotic derived from gram-positive Actinoplanes used to treat infection with Clostridioides difficile. |
| SMILES | CC(C)C/C=C/C=C\C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]1C(=O)N[C@H](c2ccc(O)cc2)C(=O)N[C@H](CCCN)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@@H](c2ccc(O)cc2)C(=O)N[C@H](c2ccc(O)cc2)C(=O)N[C@@H]([C@H](C)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](CCCN)C(=O)N[C@@H](c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](c2ccc(O)cc2)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](c2ccc(O)c(Cl)c2)C(=O)O[C@@H]1C(N)=O |
| PubChem | 16132338 |
| CHEBI | 29670 |
| ChEMBL | CHEMBL2368737 |
| Drug Class | peptide antibiotic, nonribosomal peptide antibiotics |
| Classification | 4 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + peptide antibiotic [Drug Class] + nonribosomal peptide antibiotics [Drug Class] |
| Parent Term(s) | 1 ontology terms | Show |
| Publications | Cheng M, et al. 2014. Antimicrob. Agents Chemother. 58(11):6819-27 Ramoplanin at bactericidal concentrations induces bacterial membrane depolarization in Staphylococcus aureus. (PMID 25182650) |
| Curator | Description | Most Recent Edit |
|---|