| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3005070 |
| Definition | A glycopeptide antibiotic which binds to essential peptidoglycan hydrolases, thereby preventing autolysis and inhibited cell wall remodelling during growth. |
| SMILES | CN1C(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC(=O)[C@@H]2NC(=O)[C@@H](c3cc(Cl)c(O)c(Cl)c3)NC(=O)[C@H](NC(=O)C(=O)c3cc(Cl)c(O)c(Cl)c3)Cc3c[nH]c4cc(ccc34)-c3cc2cc(c3O)Oc2ccc(cc2)C[C@H]1C(=O)N[C@@H](C(=O)O)c1ccc(O)cc1 |
| PubChem | 16134403 |
| CHEBI | 66093 |
| ChEMBL | CHEMBL506605 |
| Drug Class | peptide antibiotic, nonribosomal peptide antibiotics, glycopeptide antibiotic |
| Classification | 4 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + peptide antibiotic [Drug Class] + nonribosomal peptide antibiotics [Drug Class] |
| Parent Term(s) | 1 ontology terms | Show + glycopeptide antibiotic [Drug Class] |
| Publications | Culp EJ, et al. 2020. Nature 578(7796):582-587 Evolution-guided discovery of antibiotics that inhibit peptidoglycan remodelling. (PMID 32051588) |
| Curator | Description | Most Recent Edit |
|---|