| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007095 |
| Synonym(s) | Actonel Atelvia Benet Risedronic acid |
| Definition | Risedronate is a bisphosphonate used as an oral medication to treat osteoperosis and Paget's disease of bone. It has been shown to inhibit the action of New Delhi metallo-beta-lactamase-1. |
| SMILES | O=P(O)(O)C(O)(Cc1cccnc1)P(=O)(O)O |
| PubChem | 5245 |
| ChEBI | 8869 |
| CAS | 105462-24-6 |
| ChEMBL | CHEMBL923 |
| AMR Gene Family | NDM beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 23 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase + beta-lactamase + antibiotic molecule + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + beta-lactam antibiotic + class B (metallo-) beta-lactamase + subclass B1 (metallo-) beta-lactamase + beta-lactamase inhibitor + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + carbapenem [Drug Class] + metallo-beta-lactamase inhibitor + imipenem [Antibiotic] + NDM beta-lactamase [AMR Gene Family] + meropenem [Antibiotic] + ertapenem [Antibiotic] |
| Parent Term(s) | 2 ontology terms | Show |
| Publications | Muteeb G, et al. 2022. Molecules 27(4): Risedronate and Methotrexate Are High-Affinity Inhibitors of New Delhi Metallo-β-Lactamase-1 (NDM-1): A Drug Repurposing Approach. (PMID 35209073) |
| Curator | Description | Most Recent Edit |
|---|