| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007504 |
| Definition | Amphotericin B is an antibiotic, particularly antifungal, derived from polyene. It exhibits strong antifungal action against a variety of fungi species and is typically considered the gold standard of antifungals. |
| SMILES | C[C@@H]1[C@H](O)[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](N)[C@@H]2O)C[C@@H]2O[C@](O)(C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@H]1C)C[C@H](O)[C@H]2C(=O)O |
| PubChem | 5280965 |
| ChEBI | 2682 |
| CAS | 1397-89-3 |
| ChEMBL | CHEMBL267345 |
| Drug Class | polyene antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + polyene antibiotic [Drug Class] |
| Sub-Term(s) | 1 ontology terms | Show + antifungal resistance-associated MSH2 [AMR Gene Family] confers_resistance_to_antibiotic |
| Publications | Cavassin FB, et al. 2021. Infect Dis Ther 10(1):115-147 Sixty years of Amphotericin B: An Overview of the Main Antifungal Agent Used to Treat Invasive Fungal Infections. (PMID 33523419) |
| Curator | Description | Most Recent Edit |
|---|
