| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007511 |
| Definition | Itraconazole is a type of triazole antibiotic, particularly antifungal. It has broad spectrum activity against Candida and Malassezia species and Dermatophytes. |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| PubChem | 55283 |
| ChEBI | 6076 |
| CAS | 84625-61-6 |
| ChEMBL | CHEMBL64391 |
| Drug Class | triazole antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + triazole antibiotic [Drug Class] |
| Sub-Term(s) | 4 ontology terms | Show + Candida spp. ERG11 with mutations conferring resistance to azole antibiotics confers_resistance_to_antibiotic + Aspergillus spp. cyp51A with mutations conferring resistance to triazoles antibiotics confers_resistance_to_antibiotic + Candida spp. cyp51A1 with mutations conferring resistance to triazoles and imidazole antibiotics confers_resistance_to_antibiotic + Aspergillus spp. Hmg1 with mutations conferring resistance to triazoles antibiotics confers_resistance_to_antibiotic |
| Publications | Heykants J, et al. 1989. Mycoses 32 Suppl 1:67-87 The clinical pharmacokinetics of itraconazole: an overview. (PMID 2561187) |
| Curator | Description | Most Recent Edit |
|---|