| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007512 |
| Definition | Voriconazole is a type of triazole antibiotic, particularly antifungal. It is used for the treatment of invasive aspergillosis, candidaemia, and infections caused by Candida spp. |
| SMILES | C[C@@H](c1ncncc1F)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| PubChem | 71616 |
| ChEMBL | CHEMBL638 |
| ChEBI | 10023 |
| CAS | 137234-62-9 |
| Drug Class | triazole antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + triazole antibiotic [Drug Class] |
| Sub-Term(s) | 4 ontology terms | Show + Candida spp. ERG11 with mutations conferring resistance to azole antibiotics confers_resistance_to_antibiotic + Aspergillus spp. cyp51A with mutations conferring resistance to triazoles antibiotics confers_resistance_to_antibiotic + Aspergillus spp. Hmg1 with mutations conferring resistance to triazoles antibiotics confers_resistance_to_antibiotic + antifungal resistance-associated MSH2 [AMR Gene Family] confers_resistance_to_antibiotic |
| Publications | Greer ND, et al. 2003. Proc (Bayl Univ Med Cent) 16(2):241-8 Voriconazole: the newest triazole antifungal agent. (PMID 16278744) |
| Curator | Description | Most Recent Edit |
|---|