| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007513 |
| Definition | Posaconazole is a type of triazole antibiotic, particularly antifungal. It has broad spectrum activity against Candida albicans and Aspergillus fumigatus. |
| SMILES | CC[C@@H]([C@H](C)O)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6cncn6)(c6ccc(F)cc6F)C5)cc4)CC3)cc2)c1=O |
| PubChem | 468595 |
| ChEBI | 64355 |
| CAS | 171228-49-2 |
| ChEMBL | CHEMBL1397 |
| Drug Class | triazole antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + triazole antibiotic [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + Aspergillus spp. cyp51A with mutations conferring resistance to triazoles antibiotics confers_resistance_to_antibiotic + Aspergillus spp. Hmg1 with mutations conferring resistance to triazoles antibiotics confers_resistance_to_antibiotic |
| Publications | Cacciapuoti A, et al. 2000. Antimicrob Agents Chemother 44(8):2017-22 In vitro and in vivo activities of SCH 56592 (posaconazole), a new triazole antifungal agent, against Aspergillus and Candida. (PMID 10898669) |
| Curator | Description | Most Recent Edit |
|---|