| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3009162 |
| Definition | This compound is a small molecule antifungal drug with a maximum clinical trial phase of II. The compound inhibits 14a demethylase, an enzyme involved in sterol synthesis, resulting in lysis of the fungal cell wall and fungal cell death. |
| SMILES | C[C@@H](C1=NC(=CS1)C2=CC=C(C=C2)C#N)[C@](CN3C=NC=N3)(C4=C(C=C(C=C4)F)F)O |
| PubChem | 467825 |
| ChEMBL | CHEMBL294029 |
| Drug Class | azole antibiotic, triazole antifungal |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + triazole antifungal [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + Aspergillus fumigatus cyp51a with mutations conferring resistance to ravuconazole confers_resistance_to_antibiotic + Aspergillus flavus Cyp51A with mutations conferring resistance to ravuconazole confers_resistance_to_antibiotic |
| Publications | Krishnan-Natesan S, et al. 2008. Int J Antimicrob Agents 32(6):519-24 Molecular characterisation of cyp51A and cyp51B genes coding for P450 14alpha-lanosterol demethylases A (CYP51Ap) and B (CYP51Bp) from voriconazole-resistant laboratory isolates of Aspergillus flavus. (PMID 18775650) |
| Curator | Description | Most Recent Edit |
|---|