| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3009189 |
| Definition | Cyproconazole is a fungicide that prevents wood decay from fungi in above-ground applications, but is not intended to protect trees in the ground. |
| SMILES | CC(C1CC1)C(CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O |
| PubChem | 86132 |
| ChEMBL | CHEMBL2131954 |
| CHEBI | 83748 |
| CAS | 94361-06-5 |
| Drug Class | azole antibiotic, triazole antifungal |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + triazole antifungal [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + Zymoseptoria tritici MgAtr with mutations conferring resistance to cyproconazole confers_resistance_to_antibiotic + Phakospora pachyrhizi Cyp51 with mutations conferring resistance to cyproconazole confers_resistance_to_antibiotic |
| Publications | Schmitz HK, et al. 2014. Pest Manag Sci 70(3):378-88 Sensitivity of Phakopsora pachyrhizi towards quinone-outside-inhibitors and demethylation-inhibitors, and corresponding resistance mechanisms. (PMID 23589453) |
| Curator | Description | Most Recent Edit |
|---|