| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3009302 |
| Definition | Metconazole is a triazole antifungal used to control a range of fungal infections through its role as a sterol 14alpha-demethylase inhibitor. |
| SMILES | CC1(CCC(C1(CN2C=NC=N2)O)CC3=CC=C(C=C3)Cl)C |
| PubChem | 86210 |
| CAS | 125116-23-6 |
| CHEBI | 81773 |
| ChEMBL | CHEMBL1883512 |
| Drug Class | azole antibiotic, triazole antifungal |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + triazole antifungal [Drug Class] |
| Sub-Term(s) | 6 ontology terms | Show + Colletotrichum truncatum cyp51a with mutations associated with resistance to metconazole confers_resistance_to_antibiotic + Zymoseptoria tritici mfs1 with mutations conferring resistance to metconazole confers_resistance_to_antibiotic + Aspergillus flavus Cyp51c with mutations conferring resistance to metconazole confers_resistance_to_antibiotic + Fusarium graminearum Cyp51A with mutations associated with resistance to metconazole confers_resistance_to_antibiotic + Phakospora pachyrhizi Cyp51 with mutations conferring resistance to metconazole confers_resistance_to_antibiotic + Pyrenopeziza brassicae Cyp51 with mutations conferring resistance to metconazole confers_resistance_to_antibiotic |
| Publications | Edwards SG, et al. 2001. Appl Environ Microbiol 67(4):1575-80 Quantification of trichothecene-producing Fusarium species in harvested grain by competitive PCR to determine efficacies of fungicides against Fusarium head blight of winter wheat. (PMID 11282607) |
| Curator | Description | Most Recent Edit |
|---|