| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000009 |
| Definition | Tunicamycin is mixture of homologous nucleoside antibiotics that block the reaction of UDP-N-acetylglucosamine and dolichyl phosphate in the first step of glycoprotein synthesis. |
| SMILES | CC(=O)N[C@H]1[C@@H](O[C@@H]2O[C@H](CC(O)[C@H]3O[C@@H](n4ccc(=O)[nH]c4=O)[C@H](O)[C@@H]3O)[C@H](O)[C@H](O)[C@H]2NC(=O)/C=C/CC(C)C)O[C@H](CO)[C@@H](N)[C@@H]1O |
| PubChem | 5354023 |
| ChEBI | 29699 |
| CAS | 11089-65-9 |
| ChEMBL | CHEMBL505513 |
| Drug Class | nucleoside antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 2 ontology terms | Show |
| Sub-Term(s) | 2 ontology terms | Show + tmrB confers_resistance_to_antibiotic + tunicamycin resistance protein [AMR Gene Family] confers_resistance_to_antibiotic |
| Publications | Noda Y, et al. 1992. J Bacteriol 174(13): 4302-4307. TmrB protein, responsible for tunicamycin resistance of Bacillus subtilis, is a novel ATP-binding membrane protein. (PMID 1624425) |
| Curator | Description | Most Recent Edit |
|---|
