| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000554 |
| Synonym(s) | pseudomonic acid |
| Definition | Mupirocin, also known as pseudomonic acid, is a bacteriostatic polyketide antibiotic from Pseudomonas fluorescens used to treat S. aureus and MRSA. It inhibits Ile tRNA synthetase. |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O |
| PubChem | 446596 |
| ChEMBL | CHEMBL719 |
| CHEBI | 7025 |
| CAS | 12650-69-0 |
| Drug Class | mupirocin-like antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + mupirocin-like antibiotic [Drug Class] |
| Sub-Term(s) | 5 ontology terms | Show + Staphylococcus aureus mupA conferring resistance to mupirocin confers_resistance_to_antibiotic + Staphylococcus aureus mupB conferring resistance to mupirocin confers_resistance_to_antibiotic + Bifidobacterium bifidum ileS conferring resistance to mupirocin confers_resistance_to_antibiotic + Staphylococcus aureus ileS with mutation conferring resistance to mupirocin confers_resistance_to_antibiotic + antibiotic sensitive Isoleucyl-tRNA transferase targeted_by_antibiotic |
| Publications | Gurney R and Thomas CM. 2011. Appl Microbiol Biotechnol 90(1): 11-21. Mupirocin: biosynthesis, special features and applications of an antibiotic from a gram-negative bacterium. (PMID 21336932) |
| Curator | Description | Most Recent Edit |
|---|