| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000761 |
| Synonym(s) | amdinocillin Selexid Selexidin |
| Definition | Mecillinam is a broad-spectrum beta-lactam antibiotic that was semi-synthetically derived to have a different drug centre, being a 6-alpha-amidinopenicillanate instead of a 6-alpha-acylaminopenicillanate. Contrasting most beta-lactam drugs, mecillinam is most active against Gram-negative bacteria. It binds specifically to penicillin binding protein 2 (PBP2). |
| SMILES | CC1(C)S[C@@H]2[C@H](/N=C/N3CCCCCC3)C(=O)N2[C@H]1C(=O)O |
| PubChem | 36273 |
| ChEMBL | CHEMBL530 |
| ChEBI | 51208 |
| CAS | 32887-01-7 |
| Drug Class | penicillin beta-lactam |
| Classification | 4 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 1 ontology terms | Show + beta-lactam sensitive penicillin-binding protein targeted_by_antibiotic |
| Publications | [Editors]. 1983. Am J Med 75(2A): 1-138. An international review of amdinocillin: a new beta-lactam antibiotic. (PMID 6310995) |
| Curator | Description | Most Recent Edit |
|---|