| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3001220 |
| Definition | Factumycin is a kirromycin-like antibiotic produced by Kitasatospora setae and Streptomyces strains. Its biosynthetic cluster has been characterized which has interesting acetyl transferase domains in trans, or outside of the polyketide synthase domains. Factumycin has specific, rather than broad spectrum, antibacterial properties, especially targeting various Acinetobacter baumanii strains. |
| SMILES | C/C=C\C=C\[C@@H]1O[C@](O)([C@H](CC)C(=O)NC/C=C/C=C(\C)[C@@H](OC)[C@@H](C)C(O)[C@@H](O)/C=C/C=C/C=C/C=C(\C)C(=O)c2c(O)ccn(C)c2=O)C[C@H](O)C1(C)C |
| PubChem | 135410114 |
| CHEBI | 216503 |
| ChEMBL | CHEMBL3218567 |
| Drug Class | elfamycin antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 1 ontology terms | Show + facT confers_resistance_to_antibiotic |
| Publications | Gullo VP, et al. 1982. J Antibiot (Tokyo) 35(12): 1705-1707. Factumycin, a new antibiotic (A40A): fermentation, isolation and antibacterial spectrum. (PMID 7166535) |
| Curator | Description | Most Recent Edit |
|---|