| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3002980 |
| Synonym(s) | BRN 2422056 Toxin C |
| Definition | Aspergillomarasmine A, a fungal natural product, has been shown to inhibit the NDM-1 and VIM-2 enzymes, restoring of the activity of meropenem against carbapenem-resistant pathogens possessing either NDM-1 or VIM-2. |
| SMILES | N[C@@H](CN[C@@H](CN[C@@H](CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| PubChem | 197028 |
| ChEBI | 180884 |
| ChEMBL | CHEMBL4087144 |
| Classification | 5 ontology terms | Show |
| Parent Term(s) | 3 ontology terms | Show + is_small_molecule_inhibitor_of NDM-1 + is_small_molecule_inhibitor_of VIM-2 + unclassified metallo-beta-lactamase inhibitor |
| Publications | King AM, et al. 2014. Nature 510(7506): 503-506. Aspergillomarasmine A overcomes metallo-beta-lactamase antibiotic resistance. (PMID 24965651) Koteva K, et al. 2022. ACS Omega 7(5):4170-4184 Three-Dimensional Structure and Optimization of the Metallo-β-Lactamase Inhibitor Aspergillomarasmine A. (PMID 35155911) |
| Curator | Description | Most Recent Edit |
|---|