| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003241 |
| Definition | Teixobactin is a peptide antibiotic isolated from the Gram-negative bacteria, Eleftheria terrae. It inhibits the synthesis of peptidoglycan by interacting with peptidoglycan precursor, Lipid II and Lipid III. |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)[C@@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H](Cc1ccccc1)NC)[C@@H](C)CC)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H](C[C@H]2CNC(=N)N2)C(=O)N[C@@H]([C@@H](C)CC)C(=O)O[C@H]1C)[C@@H](C)CC |
| PubChem | 86341926 |
| CHEBI | 84192 |
| ChEMBL | CHEMBL3977597 |
| Drug Class | peptide antibiotic, nonribosomal peptide antibiotics |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + nonribosomal peptide antibiotics [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show |
| Publications | Ling LL, et al. 2015. Nature 517(7535): 455-459. A new antibiotic kills pathogens without detectable resistance. (PMID 25561178) |
| Curator | Description | Most Recent Edit |
|---|
