| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003412 |
| Synonym(s) | diaminodiphenyl sulfone |
| Definition | Dapsone is a sulfone in which it inhibits folic acid synthesis, such as the dihydropteroate synthase. |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| PubChem | 2955 |
| CHEBI | 4325 |
| CAS | 80-08-0 |
| ChEMBL | CHEMBL1043 |
| Drug Class | sulfone antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + sulfone antibiotic [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + antibiotic sensitive dihydropteroate synthase targeted_by_antibiotic + Mycobacterium leprae folP with mutation conferring resistance to dapsone confers_resistance_to_antibiotic |
| Publications | Zhu YI, et al. 2001. J Am Acad Dermatol 45(3):420-34 Dapsone and sulfones in dermatology: overview and update. (PMID 11511841) Agrawal S, et al. 2005. J Dermatol 32(11):883-9 Dapsone hypersensitivity syndrome: a clinico-epidemiological review. (PMID 16361748) |
| Curator | Description | Most Recent Edit |
|---|