| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003571 |
| Definition | Magainin1 is an antimicrobial peptides produced by amphibians as part of their innate immune system. It is derived from the Xenopus laevis. |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](NC(=O)CN)[C@@H](C)CC)C(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(N)=O |
| PubChem | 16132169 |
| CHEBI | 201898 |
| ChEMBL | CHEMBL437357 |
| Drug Class | peptide antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + magainin |
| Publications | Zasloff M, et al. 1988. Proc Natl Acad Sci U S A 85(3): 910-913. Antimicrobial activity of synthetic magainin peptides and several analogues. (PMID 3277183) |
| Curator | Description | Most Recent Edit |
|---|