| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003572 |
| Definition | Magainin 2 is an antimicrobial peptides produced from Xenopus laevis skin. It induce osmotic lysis of bacteria. |
| SMILES | CC[C@H](C)[C@H](NC(=O)CN)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)CC)C(C)C |
| PubChem | 16130189 |
| ChEBI | 201476 |
| ChEMBL | CHEMBL414933 |
| Drug Class | peptide antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + magainin |
| Publications | Zasloff M, et al. 1988. Proc Natl Acad Sci U S A 85(3): 910-913. Antimicrobial activity of synthetic magainin peptides and several analogues. (PMID 3277183) |
| Curator | Description | Most Recent Edit |
|---|