| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003916 |
| Synonym(s) | Vitamin K2 |
| Definition | A molecule involved in electron transport in bacterial cell membrane. |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC1=C(C)C(=O)c2ccccc2C1=O |
| PubChem | 5287554 |
| ChEBI | 16374 |
| CAS | 11032-49-8 |
| ChEMBL | CHEMBL4297659 |
| Drug Class | peptide antibiotic |
| Classification | 23 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + peptide antibiotic [Drug Class] + lipopeptide antibiotic + antibiotic mixture + polymyxin antibiotic + polymyxin B [Antibiotic] + gramicidin [Antibiotic] + colistin + lysocin + antibiotic target + magainin + defensin [Antibiotic] + polymyxin B4 [Antibiotic] + polymyxin B3 [Antibiotic] + polymyxin B2 [Antibiotic] + polymyxin B1 [Antibiotic] + colistin B [Antibiotic] + colistin A [Antibiotic] + gramicidin C [Antibiotic] + gramicidin B [Antibiotic] + gramicidin A [Antibiotic] + gramicidin S [Antibiotic] |
| Parent Term(s) | 3 ontology terms | Show + antibiotic target + cell membrane component targeted by antibiotic + targeted_by_antibiotic Lysocin E [Antibiotic] |
| Publications | Hamamoto H, et al. 2015. Nat. Chem. Biol. 11(2):127-33 Lysocin E is a new antibiotic that targets menaquinone in the bacterial membrane. (PMID 25485686) |
| Curator | Description | Most Recent Edit |
|---|