| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003951 |
| Synonym(s) | MccJ25 |
| Definition | Microcin J25 is a peptide antibiotic that inhibits transcription by bacterial RNA polymerase. MccJ25 is produced by Escherichia coli strains that harbor a plasmid-borne antibiotic-synthesis and antibiotic-export cassette, consisting of a gene for MccJ25 precursor (a 58 residue linear peptide), two genes for factors that process MccJ25 precursor into MccJ25, and one gene for export of MccJ25. |
| SMILES | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCC(=O)NCC(=O)NCC(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](Cc2cnc[nH]2)C(=O)N[C@@H](C(C)C)C(=O)N2CCC[C@H]2C(=O)N1)C(C)C)C(=O)NCC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)O)[C@@H](C)CC)[C@@H](C)O |
| PubChem | 10793809 |
| ChEBI | 203056 |
| ChEMBL | CHEMBL1945674 |
| Drug Class | peptide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + peptide antibiotic [Drug Class] |
| Sub-Term(s) | 1 ontology terms | Show + YojI confers_resistance_to_antibiotic |
| Publications | Mukhopadhyay J, et al. 2004. Mol. Cell 14(6):739-51 Antibacterial peptide microcin J25 inhibits transcription by binding within and obstructing the RNA polymerase secondary channel. (PMID 15200952) |
| Curator | Description | Most Recent Edit |
|---|