| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3004001 |
| Synonym(s) | CMZ |
| Definition | Cefmetazole is a semi-synthetic cephamycin antibiotic with broad spectrum antibiotic activity against both gram-positive and gram-negative bacteria, that disrupt cell wall synthesis through binding to PBPs causing cell lysis. |
| SMILES | CO[C@@]1(NC(=O)CSCC#N)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]21 |
| PubChem | 42008 |
| CHEBI | 3489 |
| CAS | 56796-20-4 |
| ChEMBL | CHEMBL1201195 |
| Drug Class | cephalosporin |
| Classification | 4 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + second-generation cephalosporin [Drug Subclass] |
| Sub-Term(s) | 2 ontology terms | Show + beta-lactam sensitive penicillin-binding protein targeted_by_antibiotic + CfxA confers_resistance_to_antibiotic |
| Publications | 1979. InPharma 175: 17–18 Cefmetazole: a second cephamycin. (DOI 10.1007/BF03298293) Jones RN, et al. 1989. Diagn Microbiol Infect Dis 12(5):367-79 Cefmetazole (CS-1170), a new cephamycin with a decade of clinical experience. (PMID 2692950) |
| Curator | Description | Most Recent Edit |
|---|