| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007296 |
| Definition | Zidebactam is a diazabicyclooctane that inhibitors a variety of class A and C beta-lactamases. |
| SMILES | O=C(NNC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)[C@@H]1CCCNC1 |
| PubChem | 77846445 |
| ChEMBL | CHEMBL4533605 |
| AMR Gene Family | ADC beta-lactamase without carbapenemase activity, PDC beta-lactamase, KPC beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 24 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + beta-lactamase + antibiotic molecule + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + class C beta-lactamase + beta-lactam antibiotic + ADC beta-lactamase + class A beta-lactamase + beta-lactamase inhibitor + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + carbapenem [Drug Class] + monobactam [Drug Class] + serine beta-lactamase inhibitor + ADC beta-lactamase without carbapenemase activity [AMR Gene Family] + PDC beta-lactamase [AMR Gene Family] + KPC beta-lactamase [AMR Gene Family] |
| Parent Term(s) | 4 ontology terms | Show + is_small_molecule_inhibitor_of KPC-2 + is_small_molecule_inhibitor_of PDC-2 + is_small_molecule_inhibitor_of ADC-7 + diazabicyclooctane |
| Publications | Bhagwat SS, et al. 2019. Antimicrob Agents Chemother 63(4): The Novel β-Lactam Enhancer Zidebactam Augments the In Vivo Pharmacodynamic Activity of Cefepime in a Neutropenic Mouse Lung Acinetobacter baumannii Infection Model. (PMID 30670419) |
| Curator | Description | Most Recent Edit |
|---|