| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007310 |
| Definition | Aranorosin is a plant derived compound that has shown inhibitory activity against certain aminoglycoside inactivation enzymes. |
| SMILES | CCCCCC[C@H](C)/C=C(C)/C=C/C(=O)N[C@@H]1C[C@@]2(O[C@@H]1O)[C@@H]1O[C@@H]1C(=O)[C@@H]1O[C@@H]12 |
| PubChem | 6444217 |
| ChEMBL | CHEMBL4646330 |
| ChEBI | 221931 |
| AMR Gene Family | aminoglycoside bifunctional resistance protein |
| Drug Class | aminoglycoside antibiotic |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 22 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic molecule + antibiotic inactivation [Resistance Mechanism] + antibiotic mixture + antibiotic inactivation enzyme + aminoglycoside antibiotic [Drug Class] + gentamicin [Antibiotic] + aminoglycoside modifying enzyme + resistance-modifying agents + aminoglycoside bifunctional resistance protein [AMR Gene Family] + 5-episisomicin [Antibiotic] + 2'-N-ethylnetilmicin [Antibiotic] + inhibitor of antibiotic resistance mechanism + gentamicin A [Antibiotic] + tobramycin [Antibiotic] + kanamycin A [Antibiotic] + netilmicin [Antibiotic] + sisomicin [Antibiotic] + amikacin [Antibiotic] + dibekacin [Antibiotic] |
| Parent Term(s) | 2 ontology terms | Show + is_small_molecule_inhibitor_of AAC(6')-Ie-APH(2'')-Ia bifunctional protein + inhibitor of aminoglycoside inactivation enzyme |
| Publications | Suga T, et al. 2012. J Antibiot (Tokyo) 65(10):527-9 Aranorosin circumvents arbekacin-resistance in MRSA by inhibiting the bifunctional enzyme AAC(6')/APH(2″). (PMID 22760297) |
| Curator | Description | Most Recent Edit |
|---|