| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007311 |
| Definition | Pterostilbene is a stilbenoid compound with antioxidant effects found in members of the genus Vaccinium (blueberries). It has also been shown to partially inhibit the mobile colistin resistance gene MCR-1. |
| SMILES | COc1cc(/C=C/c2ccc(O)cc2)cc(OC)c1 |
| PubChem | 5281727 |
| CHEBI | 8630 |
| CAS | 537-42-8 |
| ChEMBL | CHEMBL83527 |
| AMR Gene Family | MCR phosphoethanolamine transferase |
| Drug Class | peptide antibiotic, nonribosomal peptide antibiotics |
| Resistance Mechanism | antibiotic target alteration |
| Classification | 18 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + peptide antibiotic [Drug Class] + nonribosomal peptide antibiotics [Drug Class] + mechanism of antibiotic resistance + lipopeptide antibiotic + antibiotic target alteration [Resistance Mechanism] + charge alteration conferring antibiotic resistance + determinant of antibiotic resistance + polymyxin antibiotic + gene altering cell wall charge + colistin + phosphoethanolamine transferase conferring colistin resistance + colistin B [Antibiotic] + colistin A [Antibiotic] + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + MCR phosphoethanolamine transferase [AMR Gene Family] |
| Parent Term(s) | 2 ontology terms | Show |
| Publications | Zhou Y, et al. 2018. Antimicrob Agents Chemother 62(4): Pterostilbene, a Potential MCR-1 Inhibitor That Enhances the Efficacy of Polymyxin B. (PMID 29339386) |
| Curator | Description | Most Recent Edit |
|---|