| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007502 |
| Definition | Micafungin is an antibiotic, particularly antifungal, derived from echinocandins. It was discovered at Fujisawa Pharmaceutical Co., Ltd. It is active against most Candida species. |
| SMILES | CCCCCOc1ccc(-c2cc(-c3ccc(C(=O)N[C@H]4C[C@@H](O)[C@@H](O)NC(=O)[C@@H]5[C@@H](O)[C@@H](C)CN5C(=O)[C@H]([C@H](O)CC(N)=O)NC(=O)[C@H]([C@H](O)[C@@H](O)c5ccc(O)c(OS(=O)(=O)O)c5)NC(=O)[C@@H]5C[C@@H](O)CN5C(=O)[C@H]([C@@H](C)O)NC4=O)cc3)no2)cc1 |
| PubChem | 477468 |
| ChEMBL | CHEMBL457547 |
| ChEBI | 600520 |
| Drug Class | echinocandin antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + echinocandin antibiotic [Drug Class] |
| Sub-Term(s) | 2 ontology terms | Show + Candida spp. FKS2 with mutations conferring resistance to echinocandin antibiotics confers_resistance_to_antibiotic + antifungal resistance-associated MSH2 [AMR Gene Family] confers_resistance_to_antibiotic |
| Publications | Tomishima M, et al. 2008. Bioorg Med Chem Lett 18(9):2886-90 Novel echinocandin antifungals. Part 2: Optimization of the side chain of the natural product FR901379. Discovery of micafungin. (PMID 18424132) |
| Curator | Description | Most Recent Edit |
|---|