| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007507 |
| Definition | Terbinafine is an antibiotic, particularly antifungal, derived from allylamine. Terbinafine is active against a broad range of fungi and yeast. It was discovered in 1983. |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12 |
| PubChem | 1549008 |
| ChEMBL | CHEMBL822 |
| CHEBI | 9448 |
| CAS | 91161-71-6 |
| Drug Class | allylamine antifungal |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + allylamine antifungal [Drug Class] |
| Sub-Term(s) | 8 ontology terms | Show + Candida albicans CDR2 with mutations conferring resistance to azoles confers_resistance_to_antibiotic + Arthroderma vanbreuseghemii squalene epoxidase enzyme with mutations associated with resistance to terbinafine confers_resistance_to_antibiotic + Trychophyton rubrum squalene epoxidase enzyme with mutations associated with resistance to terbinafine confers_resistance_to_antibiotic + fungal MDR confers_resistance_to_antibiotic + Microsporum canis MDR1 with mutations conferring resistance to terbinafine confers_resistance_to_antibiotic + Microsporum canis MDR2 with mutations conferring resistance to terbinafine confers_resistance_to_antibiotic + Microsporum canis MDR4 with mutations conferring resistance to terbinafine confers_resistance_to_antibiotic + Candida albicans TAC1 with mutations conferring resistance to terbinafine confers_resistance_to_antibiotic |
| Publications | Balfour JA, et al. 1992. Drugs 43(2):259-84 Terbinafine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in superficial mycoses. (PMID 1372222) |
| Curator | Description | Most Recent Edit |
|---|