| Accession | ARO:3007638 |
| Synonym(s) | totomycin |
| Definition | Hygromycin A is an antibiotic produced by Streptomyces hygroscopicus. It inhibits translation by binding to the peptidyl transferase center on the large ribosomal subunit. This prevents the binding of aminoacyl-tRNA to the A-site. Not to confused with Hygromycin B, which is structurally distinct. |
| SMILES | CC(=O)[C@H]1O[C@@H](Oc2ccc(/C=C(/C)C(=O)N[C@H]3[C@@H](O)[C@@H]4OCO[C@@H]4[C@H](O)[C@@H]3O)cc2O)[C@@H](O)[C@@H]1O |
| PubChem | 6433481 |
| ChEBI | 69414 |
| CAS | 6379-56-2 |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 3 ontology terms | Show + vmlR confers_resistance_to_antibiotic + Clostridium sporogenes cplR confers_resistance_to_antibiotic + Neobacillus vireti vmlR2 confers_resistance_to_antibiotic |
| Publications | Polikanov YS, et al. 2015. Mol Cell 58(5):832-44 Distinct tRNA Accommodation Intermediates Observed on the Ribosome with the Antibiotics Hygromycin A and A201A. (PMID 26028538) |
| Curator | Description | Most Recent Edit |
|---|
