| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3009188 |
| Definition | Cycloheximide appears as colorless crystals that can be used as a fungicide and as a anticancer drug. It is produced by the bacterium Streptomyces griseus and has a role as a bacterial metabolite, a protein synthesis inhibitor, a neuroprotective agent, an anticoronaviral agent and a ferroptosis inhibitor. It is a member of piperidones, a piperidine antibiotic, a fungicide, a dicarboximide, a secondary alcohol and a cyclic ketone. It is functionally related to a piperidine-2,6-dione. Cycloheximide can cause developmental toxicity. |
| SMILES | C[C@H]1C[C@@H](C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C |
| CHEBI | 27641 |
| ChEMBL | CHEMBL123292 |
| CAS | 4630-75-5 |
| PubChem | 2900 |
| Drug Class | antibiotic without defined classification |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 3 ontology terms | Show + Trychophyton rubrum MFS1 with mutations conferring resistance against cyclohexamide confers_resistance_to_antibiotic + Saccharomyces cerevisiae ACT1 with mutations conferring resistance to cycloheximide confers_resistance_to_antibiotic + ribosomal complex targeted_by_antibiotic |
| Publications | Nourani A, et al. 1997. Mol Cell Biol 17(9):5453-60 Multiple-drug-resistance phenomenon in the yeast Saccharomyces cerevisiae: involvement of two hexose transporters. (PMID 9271421) |
| Curator | Description | Most Recent Edit |
|---|
