| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000488 |
| Definition | Telavancin is a semi-synthetic derivative of vancomycin and is a second-generation lipoglycopeptide antibiotic. Telavancin inhibits cell wall synthesis by forming a complex with the D-Ala-D-Ala terminus of peptidoglycan precursors and preventing transglycosylation. |
| SMILES | CCCCCCCCCCNCCN[C@@]1(C)C[C@H](O[C@H]2[C@H](Oc3c4cc5cc3Oc3ccc(cc3Cl)[C@@H](O)[C@@H](NC(=O)[C@@H](CC(C)C)NC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H]5C(=O)N[C@H]3C(=O)N[C@H](C(=O)N[C@H](C(=O)O)c5cc(O)c(CNCP(=O)(O)O)c(O)c5-c5cc3ccc5O)[C@H](O)c3ccc(c(Cl)c3)O4)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H](C)[C@H]1O |
| PubChem | 3081362 |
| ChEMBL | CHEMBL507870 |
| ChEBI | 71229 |
| CAS | 372151-71-8 |
| Drug Class | glycopeptide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + glycopeptide antibiotic [Drug Class] |
| Sub-Term(s) | 1 ontology terms | Show + acyl-D-alanyl-D-alanine targeted_by_antibiotic |
| Publications | Smith WJ and Drew RH. 2009. Drugs Today (Barc) 45(3): 159-173. Telavancin: a new lipoglycopeptide for gram-positive infections. (PMID 19436839) Charneski L, et al. 2009. Ann Pharmacother 43(5): 928-938. Telavancin: a novel lipoglycopeptide antibiotic. (PMID 19401479) Nannini EC and Stryjewski ME. 2008. Expert Opin Pharmacother 9(12): 2197-2207. A new lipoglycopeptide: telavancin. (PMID 18671473) |
| Curator | Description | Most Recent Edit |
|---|