| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3001221 |
| Definition | A macrolide antibiotic from Streptomyces narbonensis subsp. josamyceticus. The drug has antimicrobial activity against a wide spectrum of pathogens. |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](OC(=O)CC(C)C)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)[C@@H](O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1OC(C)=O |
| PubChem | 5284579 |
| CAS | 16846-24-5 |
| ChEBI | 31739 |
| ChEMBL | CHEMBL224436 |
| Drug Class | macrolide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + macrolide antibiotic [Drug Class] |
| Sub-Term(s) | 3 ontology terms | Show + Streptococcus pneumoniae 23S rRNA mutation conferring resistance to macrolides and streptogramins antibiotics confers_resistance_to_antibiotic + ErmW confers_resistance_to_antibiotic + Chlamydia trachomatis 23S rRNA with mutation conferring resistance to macrolide antibiotics confers_resistance_to_antibiotic |
| Curator | Description | Most Recent Edit |
|---|