| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003690 |
| Synonym(s) | Gracevit |
| Definition | Sitafloxacin is a fluoroquinolone active against multi-resistant Gram-positive and negative pathogens. Sitafloxacin shows inhibitory activity against DNA gyrase and topoisomerase IV, which blocks bacterial DNA replication, thereby causing double-stranded breaks in the bacterial chromosome. |
| SMILES | N[C@@H]1CN(c2c(F)cc3c(=O)c(C(=O)O)cn([C@@H]4C[C@@H]4F)c3c2Cl)CC12CC2.O |
| PubChem | 461399 |
| CHEBI | 4304 |
| CAS | 127254-12-0 |
| ChEMBL | CHEMBL3989504 |
| Drug Class | fluoroquinolone antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + fluoroquinolone antibiotic [Drug Class] |
| Sub-Term(s) | 3 ontology terms | Show + Pseudomonas aeruginosa gyrA conferring resistance to fluoroquinolones confers_resistance_to_antibiotic + Neisseria gonorrhoeae gyrA with mutations conferring resistance to fluoroquinolones confers_resistance_to_antibiotic + Neisseria gonorrhoeae parC conferring resistance to fluoroquinolones confers_resistance_to_antibiotic |
| Publications | Keating GM, et al. 2011. Drugs 71(6):731-44 Sitafloxacin: in bacterial infections. (PMID 21504249) |
| Curator | Description | Most Recent Edit |
|---|