| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3003927 |
| Synonym(s) | Zerbaxa |
| Definition | Ceftolozane is a fifth-generation cephalosporin antibiotic developed for the treatment of infections with gram-negative bacteria that have become resistant to conventional antibiotics. |
| SMILES | Cn1c(N)c(NC(=O)NCCN)c[n+]1CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N\OC(C)(C)C(=O)[O-])c3nsc(N)n3)[C@H]2SC1 |
| PubChem | 53234134 |
| ChEBI | 134719 |
| CAS | 689293-68-3 |
| ChEMBL | CHEMBL2103872 |
| Drug Class | cephalosporin |
| Classification | 4 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 3 ontology terms | Show + CAM-1 confers_resistance_to_antibiotic + CMY-136 confers_resistance_to_antibiotic + ceftolozane-tazobactam [Antibiotic+Adjuvant] has_part |
| Publications | Vickery SB, et al. 2016. Pharmacotherapy : Successful Use of Ceftolozane-Tazobactam to Treat a Pulmonary Exacerbation of Cystic Fibrosis Caused by Multidrug-Resistant Pseudomonas aeruginosa. (PMID 27522066) |
| Curator | Description | Most Recent Edit |
|---|