| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3004006 |
| Synonym(s) | Excenel Naxcel |
| Definition | Ceftiofur is a third-generation broad spectrum cephalosporin and beta-lactam antibiotic predominantly used in veterinary medicine. It causes cell lysis by disrupting peptidoglycan cross-linkage and cell wall formation by binding to PBPs. |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSC(=O)c3ccco3)CS[C@H]12)c1csc(N)n1 |
| PubChem | 6328657 |
| ChEMBL | CHEMBL222913 |
| ChEBI | 31383 |
| CAS | 104010-37-9 |
| Drug Class | cephalosporin |
| Classification | 4 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 3 ontology terms | Show + beta-lactam sensitive penicillin-binding protein targeted_by_antibiotic + cefotaxime-ceftiofur-tazobactam-clavulanate [Antibiotic+Adjuvant] has_part + EBR-5 confers_resistance_to_antibiotic |
| Publications | Yancey RJ, et al. 1987. Am. J. Vet. Res. 48(7):1050-3 Ceftiofur sodium, a broad-spectrum cephalosporin: evaluation in vitro and in vivo in mice. (PMID 3631686) |
| Curator | Description | Most Recent Edit |
|---|