| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007171 |
| Definition | Enmetazobactam is a beta-lactamase inhibitor which exhibits activity against class A extended spectrum beta-lactamases. It is currently in clinical trials in combination with cefepine for the treatment of urinary tract infections and acute pyelonephritis. |
| SMILES | C[n+]1ccn(C[C@@]2(C)[C@H](C(=O)[O-])N3C(=O)C[C@H]3S2(=O)=O)n1 |
| PubChem | 23653540 |
| ChEMBL | CHEMBL4458276 |
| AMR Gene Family | OXA beta-lactamase, OXA-10-like beta-lactamase, TEM beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 28 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + mechanism of antibiotic resistance + beta-lactam antibiotic + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + penicillin beta-lactam [Drug Class] + beta-lactamase resistant penicillin + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + beta-lactamase + resistance-modifying agents + penicillin with extended spectrum + inhibitor of antibiotic resistance mechanism + class D beta-lactamase + oxacillin [Antibiotic] + cephalosporin [Drug Class] + third-generation cephalosporin + ampicillin [Antibiotic] + class A beta-lactamase + beta-lactamase inhibitor + OXA beta-lactamase [AMR Gene Family] + monobactam [Drug Class] + OXA-10-like beta-lactamase [AMR Gene Family] + serine beta-lactamase inhibitor + TEM beta-lactamase [AMR Gene Family] + ceftazidime [Antibiotic] |
| Parent Term(s) | 3 ontology terms | Show + is_small_molecule_inhibitor_of TEM-116 + is_small_molecule_inhibitor_of OXA-10 + beta-lactam derived beta-lactamase inhibitor |
| Sub-Term(s) | 1 ontology terms | Show + cefepime-enmetazobactam [Antibiotic+Adjuvant] has_part |
| Publications | Lang PA, et al. 2022. Proc Natl Acad Sci U S A 119(18):e2117310119 Studies on enmetazobactam clarify mechanisms of widely used β-lactamase inhibitors. (PMID 35486701) Bernhard F, et al. 2020. Antimicrob Agents Chemother 64(6): Pharmacokinetics-Pharmacodynamics of Enmetazobactam Combined with Cefepime in a Neutropenic Murine Thigh Infection Model. (PMID 32253212) |
| Curator | Description | Most Recent Edit |
|---|