| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007309 |
| Definition | Quercetin is a common plant flavonoid that has shown inhibitory activity against certain aminoglycoside inactivation enzymes. Quercetin is also able to inhibit antbiotic efflux pumps such as AcrAB-TolC. |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| PubChem | 5280343 |
| ChEMBL | CHEMBL50 |
| CHEBI | 16243 |
| CAS | 117-39-5 |
| AMR Gene Family | APH(3') |
| Drug Class | aminoglycoside antibiotic |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 28 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + aminoglycoside modifying enzyme + phosphorylation of antibiotic conferring resistance + antibiotic molecule + antibiotic mixture + aminoglycoside phosphotransferase (APH) + resistance-modifying agents + aminoglycoside antibiotic [Drug Class] + gentamicin [Antibiotic] + adjuvants inhibiting antibiotic removal + APH(3') [AMR Gene Family] + APH(3')-IV + APH(3')-III + inhibitor of antibiotic resistance mechanism + antibiotic efflux inhibitor + lividomycin [Antibiotic] + paromomycin [Antibiotic] + gentamicin B [Antibiotic] + isepamicin [Antibiotic] + kanamycin A [Antibiotic] + butirosin [Antibiotic] + ribostamycin [Antibiotic] + amikacin [Antibiotic] + neomycin [Antibiotic] |
| Parent Term(s) | 4 ontology terms | Show + is_small_molecule_inhibitor_of APH(3')-IIIa + is_small_molecule_inhibitor_of APH(3')-IVa + inhibitor of aminoglycoside inactivation enzyme + inhibitors of AcrAB-TolC efflux pump |
| Publications | Stogios PJ, et al. 2013. Biochem J 454(2):191-200 Structure-guided optimization of protein kinase inhibitors reverses aminoglycoside antibiotic resistance. (PMID 23758273) Pal A, et al. 2020. APMIS 128(3):251-259 Quercetin inhibits carbapenemase and efflux pump activities among carbapenem-resistant Gram-negative bacteria. (PMID 31755586) |
| Curator | Description | Most Recent Edit |
|---|