| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007639 |
| Definition | A201A is a nucleoside antibiotic. It inhibits translation by binding to the peptidyl transferase center on the large ribosomal subunit. This prevents the binding of aminoacyl-tRNA to the A-site. |
| SMILES | CO/C(CO[C@H]1O[C@H](C)[C@@H](OC)[C@H](OC)[C@@H]1O)=C1\O[C@@H](Oc2ccc(/C=C(\C)C(=O)NC3C(O)[C@H](n4cnc5c(N(C)C)ncnc54)O[C@@H]3CO)cc2)[C@@H](O)[C@@H]1O |
| PubChem | 6441582 |
| ChEBI | 222171 |
| ChEMBL | CHEMBL100042 |
| Drug Class | nucleoside antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 3 ontology terms | Show + vmlR confers_resistance_to_antibiotic + Clostridioides difficile cplR confers_resistance_to_antibiotic + Neobacillus vireti vmlR2 confers_resistance_to_antibiotic |
| Publications | Polikanov YS, et al. 2015. Mol Cell 58(5):832-44 Distinct tRNA Accommodation Intermediates Observed on the Ribosome with the Antibiotics Hygromycin A and A201A. (PMID 26028538) |
| Curator | Description | Most Recent Edit |
|---|