| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000053 |
| Synonym(s) | Blenoxane Bleocin Bleomicin Bleomycin sulfate cu-blenoxane Isobleomycin A2 |
| Definition | Bleomycin is a family of glycopeptide antibiotics produced by the bacterium Streptomyces verticillus. Bleomycins, taken as a mixture, act by the induction of DNA and RNA strand breaks. In addition to its antibacterial activity, bleomycin is also used as an anticancer agent. |
| SMILES | Cc1c(N)nc([C@H](CC(N)=O)NC[C@H](N)C(N)=O)nc1C(=O)N[C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@H](C(=O)NCCc1nc(-c2nc(C(=O)NCCC[S+](C)C)cs2)cs1)[C@@H](C)O)[C@@H](O[C@@H]1O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](OC(N)=O)[C@@H]1O)c1c[nH]cn1 |
| PubChem | 5360373 |
| ChEMBL | CHEMBL403664 |
| ChEBI | 22907 |
| Drug Class | glycopeptide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 2 ontology terms | Show |
| Sub-Term(s) | 6 ontology terms | Show + bleomycinic acid [Antibiotic] + bleomycin A2 [Antibiotic] + bleomycin B2 [Antibiotic] + BLMT confers_resistance_to_antibiotic + deoxyribonucleic acid targeted_by_antibiotic + ribonucleic acid targeted_by_antibiotic |
| Publications | Galm U, et al. 2005. Chem Rev 105(2): 739-758. Antitumor antibiotics: bleomycin, enediynes, and mitomycin. (PMID 15700963) |
| Curator | Description | Most Recent Edit |
|---|
