| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000696 |
| Synonym(s) | Actinomycin D |
| Definition | Dactinomycin, also known as Actinomycin D, is a cyclic peptide antibiotic that interacts with DNA to inhibit RNA synthesis. |
| SMILES | Cc1c2oc3c(C)ccc(C(=O)N[C@@H]4C(=O)N[C@H](C(C)C)C(=O)N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)c3nc-2c(C(=O)N[C@@H]2C(=O)N[C@H](C(C)C)C(=O)N3CCC[C@H]3C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]2C)c(N)c1=O |
| PubChem | 457193 |
| CHEBI | 27666 |
| ChEMBL | CHEMBL1554 |
| Drug Class | peptide antibiotic, nonribosomal peptide antibiotics |
| Classification | 4 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + peptide antibiotic [Drug Class] + nonribosomal peptide antibiotics [Drug Class] |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 1 ontology terms | Show + transcription complex DNA targeted_by_antibiotic |
| Publications | Sobell HM. 1985. Proc Natl Acad Sci U S A 82(16): 5328-5331. Actinomycin and DNA transcription. (PMID 2410919) |
| Curator | Description | Most Recent Edit |
|---|
