| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000759 |
| Synonym(s) | fucidin |
| Definition | Fusidic acid is the only commercially available fusidane, a group of steroid-like antibiotics. It is most active against Gram-positive bacteria, and acts by inhibiting elongation factor G to block protein synthesis. |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)[C@@H](C[C@@H](O)[C@H]3[C@@]4(C)CC[C@@H](O)[C@@H](C)[C@@H]4CC[C@@]32C)/C1=C(\CCC=C(C)C)C(=O)O |
| PubChem | 3000226 |
| ChEMBL | CHEMBL374975 |
| ChEBI | 29013 |
| CAS | 6990-06-3 |
| Drug Class | fusidane antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + fusidane antibiotic [Drug Class] |
| Sub-Term(s) | 9 ontology terms | Show + elongation factor G targeted_by_antibiotic + CmeABC confers_resistance_to_antibiotic + fusB confers_resistance_to_antibiotic + FusF confers_resistance_to_antibiotic + fusH confers_resistance_to_antibiotic + fusD confers_resistance_to_antibiotic + fusC confers_resistance_to_antibiotic + Staphylococcus aureus fusA with mutation conferring resistance to fusidic acid confers_resistance_to_antibiotic + Staphylococcus aureus fusE with mutation conferring resistance to fusidic acid confers_resistance_to_antibiotic |
| Publications | Muhonen J, et al. 2008. Anal Biochem 374(1): 133-142. Interactions of fusidic acid and elongation factor G with lipid membranes. (PMID 17980694) Drugeon HB, et al. 1994. J Antimicrob Chemother 34(6): 899-907. In-vitro antibacterial activity of fusidic acid alone and in combination with other antibiotics against methicillin-sensitive and -resistant Staphylococcus aureus. (PMID 7730233) |
| Curator | Description | Most Recent Edit |
|---|
