| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3001227 |
| Definition | Kitasamycin is a macrolide antibiotic and is produced by Streptoverticillium kitasatoense. The drug has antimicrobial activity against a wide spectrum of pathogens. |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](OC(=O)CC(C)C)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)[C@@H](O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1O |
| PubChem | 5282189 |
| CAS | 16846-24-5 |
| ChEBI | 31739 |
| ChEMBL | CHEMBL2106399 |
| Drug Class | macrolide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + macrolide antibiotic [Drug Class] |
| Sub-Term(s) | 3 ontology terms | Show + MexPQ-OpmE confers_resistance_to_antibiotic + MuxABC-OpmB confers_resistance_to_antibiotic + ErmV confers_resistance_to_antibiotic |
| Publications | Tateda K, et al. 1991. Kansenshogaku Zasshi 65(10):1337-43 [Effect of macrolide antibiotics on human serum-bactericidal sensitivity of Pseudomonas aeruginosa S-6]. (PMID 1838760) |
| Curator | Description | Most Recent Edit |
|---|
