Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3003997 |
Synonym(s) | AMC amoxicillin-clavulanate clavamox co-amoxiclav |
Definition | An antibiotic cocktail containing the beta-lactam antibiotic Amoxicillin and the beta-lactamase inhibitor Clavulanic Acid (potassium clavulanate). |
SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccc(O)cc3)C(=O)N2[C@H]1C(=O)O.O=C([O-])[C@H]1/C(=C/CO)O[C@@H]2CC(=O)N21.[K+] |
PubChem | 23665637 |
ChEBI | 201491 |
ChEMBL | CHEMBL1697738 |
Drug Class | penicillin beta-lactam |
Classification | 10 ontology terms | Show + process or component of antibiotic biology or chemistry + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + antibiotic molecule + beta-lactamase inhibitor + beta-lactam antibiotic + serine beta-lactamase inhibitor + penicillin beta-lactam [Drug Class] + penicillin with extended spectrum + beta-lactam derived beta-lactamase inhibitor |
Parent Term(s) | 3 ontology terms | Show |
Curator | Description | Most Recent Edit |
---|