| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000079 |
| Synonym(s) | Acide clavulanique Acido clavulanico acidum clavulanicum clavulanate Clavulansaeure Clavulox Isoclavulanic acid Sodium Clavulanate |
| Definition | Clavulanic acid is a beta-lactamase inhibitor (marketed by GlaxoSmithKline, formerly Beecham) combined with penicillin group antibiotics to overcome certain types of antibiotic resistance. It is used to overcome resistance in bacteria that secrete beta-lactamase, which otherwise inactivates most penicillins. |
| SMILES | O=C(O)[C@H]1/C(=C/CO)O[C@@H]2CC(=O)N21 |
| PubChem | 5280980 |
| ChEBI | 48947 |
| CAS | 58001-44-8 |
| ChEMBL | CHEMBL777 |
| Classification | 5 ontology terms | Show |
| Parent Term(s) | 20 ontology terms | Show + is_small_molecule_inhibitor_of TEM-1 + is_small_molecule_inhibitor_of TEM-2 + is_small_molecule_inhibitor_of TEM-3 + is_small_molecule_inhibitor_of TEM-5 + is_small_molecule_inhibitor_of TEM-6 + is_small_molecule_inhibitor_of TEM-7 + is_small_molecule_inhibitor_of TEM-9 + is_small_molecule_inhibitor_of TEM-10 + is_small_molecule_inhibitor_of TEM-12 + is_small_molecule_inhibitor_of TEM-26 + is_small_molecule_inhibitor_of SHV-1 + is_small_molecule_inhibitor_of SHV-2 + is_small_molecule_inhibitor_of SHV-3 + is_small_molecule_inhibitor_of SHV-5 + is_small_molecule_inhibitor_of CTX-M-1 + is_small_molecule_inhibitor_of CTX-M-8 + is_small_molecule_inhibitor_of CTX-M-14 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of CTX-M-16 + beta-lactam derived beta-lactamase inhibitor |
| Sub-Term(s) | 7 ontology terms | Show + amoxicillin-clavulanic acid [Antibiotic+Adjuvant] has_part + ticarcillin-clavulanic acid [Antibiotic+Adjuvant] has_part + ceftazidime-clavulanic acid [Antibiotic+Adjuvant] has_part + cefoxitin-clavulanate [Antibiotic+Adjuvant] has_part + cefotaxime-clavulanic acid [Antibiotic+Adjuvant] has_part + aztreonam-clavulanate [Antibiotic+Adjuvant] has_part + cefotaxime-ceftiofur-tazobactam-clavulanate [Antibiotic+Adjuvant] has_part |
| Curator | Description | Most Recent Edit |
|---|