clavulanic acid [Adjuvant]

Download Sequences


Ontology CARD's Antibiotic Resistance Ontology
Accession ARO:0000079
Synonym(s)Acide clavulanique Acido clavulanico acidum clavulanicum clavulanate Clavulansaeure Clavulox Isoclavulanic acid Sodium Clavulanate
DefinitionClavulanic acid is a beta-lactamase inhibitor (marketed by GlaxoSmithKline, formerly Beecham) combined with penicillin group antibiotics to overcome certain types of antibiotic resistance. It is used to overcome resistance in bacteria that secrete beta-lactamase, which otherwise inactivates most penicillins.
SMILESO=C(O)[C@H]1/C(=C/CO)O[C@@H]2CC(=O)N21
PubChem5280980
ChEBI48947
CAS58001-44-8
ChEMBLCHEMBL777
Classification5 ontology terms | Show
Parent Term(s)20 ontology terms | Show
+ is_small_molecule_inhibitor_of TEM-1
+ is_small_molecule_inhibitor_of TEM-2
+ is_small_molecule_inhibitor_of TEM-3
+ is_small_molecule_inhibitor_of TEM-5
+ is_small_molecule_inhibitor_of TEM-6
+ is_small_molecule_inhibitor_of TEM-7
+ is_small_molecule_inhibitor_of TEM-9
+ is_small_molecule_inhibitor_of TEM-10
+ is_small_molecule_inhibitor_of TEM-12
+ is_small_molecule_inhibitor_of TEM-26
+ is_small_molecule_inhibitor_of SHV-1
+ is_small_molecule_inhibitor_of SHV-2
+ is_small_molecule_inhibitor_of SHV-3
+ is_small_molecule_inhibitor_of SHV-5
+ is_small_molecule_inhibitor_of CTX-M-1
+ is_small_molecule_inhibitor_of CTX-M-8
+ is_small_molecule_inhibitor_of CTX-M-14
+ is_small_molecule_inhibitor_of CTX-M-15
+ is_small_molecule_inhibitor_of CTX-M-16
+ beta-lactam derived beta-lactamase inhibitor
Sub-Term(s)
7 ontology terms | Show
+ amoxicillin-clavulanic acid [Antibiotic+Adjuvant] has_part
+ ticarcillin-clavulanic acid [Antibiotic+Adjuvant] has_part
+ ceftazidime-clavulanic acid [Antibiotic+Adjuvant] has_part
+ cefoxitin-clavulanate [Antibiotic+Adjuvant] has_part
+ cefotaxime-clavulanic acid [Antibiotic+Adjuvant] has_part
+ aztreonam-clavulanate [Antibiotic+Adjuvant] has_part
+ cefotaxime-ceftiofur-tazobactam-clavulanate [Antibiotic+Adjuvant] has_part
Curator Acknowledgements
Curator Description Most Recent Edit