| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007039 |
| Synonym(s) | chlorhexidine acetate chlorhexidine digluconate chlorhexidine gluconate |
| Definition | Chlorhexidine is a disinfectant and antiseptic that is used for skin disinfection, including mouthwashes (chlorhexidine gluconate). |
| SMILES | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1 |
| PubChem | 9552079 |
| ChEMBL | CHEMBL790 |
| CHEBI | 3614 |
| CAS | 55-56-1 |
| Drug Class | disinfecting agents and antiseptics |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + disinfecting agents and antiseptics [Drug Class] |
| Sub-Term(s) | 4 ontology terms | Show + PmpM confers_resistance_to_antibiotic + Klebsiella pneumoniae KpnEF confers_resistance_to_antibiotic + Acinetobacter baumannii AbuO confers_resistance_to_antibiotic + aadT confers_resistance_to_antibiotic |
| Publications | DAVIES GE, et al. 1954. Br J Pharmacol Chemother 9(2):192-6 1:6-Di-4'-chlorophenyldiguanidohexane (hibitane); laboratory investigation of a new antibacterial agent of high potency. (PMID 13172429) |
| Curator | Description | Most Recent Edit |
|---|